C14H17FN4OS — CID 105388398
3-fluoro-2-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]pyridine-4-carboxamide (PubChem CID 105388398) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388398 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(CC(C)NC(=O)c2ccnc(NN)c2F)s1 |
| InChI | InChI=1S/C14H17FN4OS/c1-8(7-10-4-3-9(2)21-10)18-14(20)11-5-6-17-13(19-16)12(11)15/h3-6,8H,7,16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | IBBBEDMWRRCNOM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|