C16H18BrNOS — CID 65311265
5-bromo-2-methyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzamide (PubChem CID 65311265) has the molecular formula C16H18BrNOS and a molecular weight of 352.30 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzamide.
| Compound Name | 5-bromo-2-methyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 65311265 |
| Molecular Formula | C16H18BrNOS |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 5-bromo-2-methyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzamide |
| SMILES | Cc1ccc(CC(C)NC(=O)c2cc(Br)ccc2C)s1 |
| InChI | InChI=1S/C16H18BrNOS/c1-10-4-6-13(17)9-15(10)16(19)18-11(2)8-14-7-5-12(3)20-14/h4-7,9,11H,8H2,1-3H3,(H,18,19) |
| InChIKey | MLXUDLIRBHQARM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |