C10H15NO2S — CID 115641171
methyl N-[1-(5-methylthiophen-2-yl)propan-2-yl]carbamate (PubChem CID 115641171) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is methyl N-[1-(5-methylthiophen-2-yl)propan-2-yl]carbamate.
| Compound Name | methyl N-[1-(5-methylthiophen-2-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 115641171 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | methyl N-[1-(5-methylthiophen-2-yl)propan-2-yl]carbamate |
| SMILES | COC(=O)NC(C)Cc1ccc(C)s1 |
| InChI | InChI=1S/C10H15NO2S/c1-7(11-10(12)13-3)6-9-5-4-8(2)14-9/h4-5,7H,6H2,1-3H3,(H,11,12) |
| InChIKey | NQRCOLXFHFSYJB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |