C14H22N2O3S — CID 103254230
methyl 2-acetamido-3-[1-(5-methylthiophen-2-yl)propan-2-ylamino]propanoate (PubChem CID 103254230) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is methyl 2-acetamido-3-[1-(5-methylthiophen-2-yl)propan-2-ylamino]propanoate.
| Compound Name | methyl 2-acetamido-3-[1-(5-methylthiophen-2-yl)propan-2-ylamino]propanoate |
|---|---|
| PubChem CID | 103254230 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | methyl 2-acetamido-3-[1-(5-methylthiophen-2-yl)propan-2-ylamino]propanoate |
| SMILES | COC(=O)C(CNC(C)Cc1ccc(C)s1)NC(C)=O |
| InChI | InChI=1S/C14H22N2O3S/c1-9(7-12-6-5-10(2)20-12)15-8-13(14(18)19-4)16-11(3)17/h5-6,9,13,15H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | PWVMQLRZORFFPD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |