C12H14FN5OS — CID 105388401
3-fluoro-2-hydrazinyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyridine-4-carboxamide (PubChem CID 105388401) has the molecular formula C12H14FN5OS and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388401 |
| Molecular Formula | C12H14FN5OS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyridine-4-carboxamide |
| SMILES | Cc1csc(C(C)NC(=O)c2ccnc(NN)c2F)n1 |
| InChI | InChI=1S/C12H14FN5OS/c1-6-5-20-12(16-6)7(2)17-11(19)8-3-4-15-10(18-14)9(8)13/h3-5,7H,14H2,1-2H3,(H,15,18)(H,17,19) |
| InChIKey | QRAPCQIQSBVIEC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|