C13H20FN5O2 — CID 105388576
N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388576) has the molecular formula C13H20FN5O2 and a molecular weight of 297.33 g/mol. Its IUPAC name is N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388576 |
| Molecular Formula | C13H20FN5O2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[1-(tert-butylamino)-1-oxopropan-2-yl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc(NN)c1F)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H20FN5O2/c1-7(11(20)18-13(2,3)4)17-12(21)8-5-6-16-10(19-15)9(8)14/h5-7H,15H2,1-4H3,(H,16,19)(H,17,21)(H,18,20) |
| InChIKey | LRNCDWXRFXEWCH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|