C6H7FN4O — CID 105388119
3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388119) has the molecular formula C6H7FN4O and a molecular weight of 170.15 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388119 |
| Molecular Formula | C6H7FN4O |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1nccc(C(N)=O)c1F |
| InChI | InChI=1S/C6H7FN4O/c7-4-3(5(8)12)1-2-10-6(4)11-9/h1-2H,9H2,(H2,8,12)(H,10,11) |
| InChIKey | LSSPVRFBFXEYGO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|