C9H9FN6O2 — CID 105388648
3-fluoro-2-hydrazinyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide (PubChem CID 105388648) has the molecular formula C9H9FN6O2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388648 |
| Molecular Formula | C9H9FN6O2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2ccnc(NN)c2F)o1 |
| InChI | InChI=1S/C9H9FN6O2/c1-4-15-16-9(18-4)13-8(17)5-2-3-12-7(14-11)6(5)10/h2-3H,11H2,1H3,(H,12,14)(H,13,16,17) |
| InChIKey | PILQDPRNQIVFOU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|