C10H14FN5O3 — CID 106241316
N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 106241316) has the molecular formula C10H14FN5O3 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 106241316 |
| Molecular Formula | C10H14FN5O3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1nccc(C(=O)NCCOCC(N)=O)c1F |
| InChI | InChI=1S/C10H14FN5O3/c11-8-6(1-2-14-9(8)16-13)10(18)15-3-4-19-5-7(12)17/h1-2H,3-5,13H2,(H2,12,17)(H,14,16)(H,15,18) |
| InChIKey | QXFCDZDUSSBWAT-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|