C10H16FN5O3S — CID 106340899
N-[2-(ethylsulfamoyl)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 106340899) has the molecular formula C10H16FN5O3S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 106340899 |
| Molecular Formula | C10H16FN5O3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C10H16FN5O3S/c1-2-15-20(18,19)6-5-14-10(17)7-3-4-13-9(16-12)8(7)11/h3-4,15H,2,5-6,12H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | PSYOFHLEKNIESS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|