C11H13FN6O2 — CID 106423161
3-fluoro-2-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-carboxamide (PubChem CID 106423161) has the molecular formula C11H13FN6O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106423161 |
| Molecular Formula | C11H13FN6O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-carboxamide |
| SMILES | Cc1noc(CCNC(=O)c2ccnc(NN)c2F)n1 |
| InChI | InChI=1S/C11H13FN6O2/c1-6-16-8(20-18-6)3-5-15-11(19)7-2-4-14-10(17-13)9(7)12/h2,4H,3,5,13H2,1H3,(H,14,17)(H,15,19) |
| InChIKey | AXWIHJAHFSUCFB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|