C13H16FN5OS — CID 105387914
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105387914) has the molecular formula C13H16FN5OS and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387914 |
| Molecular Formula | C13H16FN5OS |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccnc(NN)c2F)n1 |
| InChI | InChI=1S/C13H16FN5OS/c1-13(2,3)8-6-21-12(17-8)18-11(20)7-4-5-16-10(19-15)9(7)14/h4-6H,15H2,1-3H3,(H,16,19)(H,17,18,20) |
| InChIKey | OYELOODLZQGPQV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|