C14H18N4OS — CID 62237194
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydrazinylbenzamide (PubChem CID 62237194) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydrazinylbenzamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 62237194 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydrazinylbenzamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccccc2NN)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-14(2,3)11-8-20-13(16-11)17-12(19)9-6-4-5-7-10(9)18-15/h4-8,18H,15H2,1-3H3,(H,16,17,19) |
| InChIKey | LVQIYJKUTBPUBM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|