C15H18N2O2S — CID 60654609
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide (PubChem CID 60654609) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 60654609 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2nc(C(C)(C)C)cs2)c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-9-5-6-11(18)10(7-9)13(19)17-14-16-12(8-20-14)15(2,3)4/h5-8,18H,1-4H3,(H,16,17,19) |
| InChIKey | DDJNDYSQSXHMPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |