C11H9IN2O2S — CID 37018478
2-hydroxy-5-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 37018478) has the molecular formula C11H9IN2O2S and a molecular weight of 360.18 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 37018478 |
| Molecular Formula | C11H9IN2O2S |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(I)ccc2O)n1 |
| InChI | InChI=1S/C11H9IN2O2S/c1-6-5-17-11(13-6)14-10(16)8-4-7(12)2-3-9(8)15/h2-5,15H,1H3,(H,13,14,16) |
| InChIKey | FYBYCCWMLOYEGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|