C13H10INO4S — CID 107731465
3-[(2-hydroxy-5-iodobenzoyl)amino]-4-methylthiophene-2-carboxylic acid (PubChem CID 107731465) has the molecular formula C13H10INO4S and a molecular weight of 403.20 g/mol. Its IUPAC name is 3-[(2-hydroxy-5-iodobenzoyl)amino]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(2-hydroxy-5-iodobenzoyl)amino]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107731465 |
| Molecular Formula | C13H10INO4S |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 3-[(2-hydroxy-5-iodobenzoyl)amino]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C13H10INO4S/c1-6-5-20-11(13(18)19)10(6)15-12(17)8-4-7(14)2-3-9(8)16/h2-5,16H,1H3,(H,15,17)(H,18,19) |
| InChIKey | LNZICDOVEPWTMH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|