C14H10Br2INO2 — CID 107731650
N-(2,6-dibromo-4-methylphenyl)-2-hydroxy-5-iodobenzamide (PubChem CID 107731650) has the molecular formula C14H10Br2INO2 and a molecular weight of 510.95 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)-2-hydroxy-5-iodobenzamide.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 107731650 |
| Molecular Formula | C14H10Br2INO2 |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 508.81 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)-2-hydroxy-5-iodobenzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(I)ccc2O)c(Br)c1 |
| InChI | InChI=1S/C14H10Br2INO2/c1-7-4-10(15)13(11(16)5-7)18-14(20)9-6-8(17)2-3-12(9)19/h2-6,19H,1H3,(H,18,20) |
| InChIKey | RKXACBJHDFUIFJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|