C14H10Br2INO — CID 60629541
N-(2,6-dibromo-4-methylphenyl)-4-iodobenzamide (PubChem CID 60629541) has the molecular formula C14H10Br2INO and a molecular weight of 494.95 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)-4-iodobenzamide.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 60629541 |
| Molecular Formula | C14H10Br2INO |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 492.82 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)-4-iodobenzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2ccc(I)cc2)c(Br)c1 |
| InChI | InChI=1S/C14H10Br2INO/c1-8-6-11(15)13(12(16)7-8)18-14(19)9-2-4-10(17)5-3-9/h2-7H,1H3,(H,18,19) |
| InChIKey | YAPGCHHXJRNCQJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|