C14H10Br2ClNO2 — CID 28881639
3-chloro-N-(2,6-dibromo-4-methylphenyl)-4-hydroxybenzamide (PubChem CID 28881639) has the molecular formula C14H10Br2ClNO2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-chloro-N-(2,6-dibromo-4-methylphenyl)-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-(2,6-dibromo-4-methylphenyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 28881639 |
| Molecular Formula | C14H10Br2ClNO2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 3-chloro-N-(2,6-dibromo-4-methylphenyl)-4-hydroxybenzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2ccc(O)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C14H10Br2ClNO2/c1-7-4-9(15)13(10(16)5-7)18-14(20)8-2-3-12(19)11(17)6-8/h2-6,19H,1H3,(H,18,20) |
| InChIKey | VBNYPNIBWWFSOH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |