C14H11Br2NO3 — CID 107722300
N-(2,6-dibromo-4-methylphenyl)-2,5-dihydroxybenzamide (PubChem CID 107722300) has the molecular formula C14H11Br2NO3 and a molecular weight of 401.05 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107722300 |
| Molecular Formula | C14H11Br2NO3 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)-2,5-dihydroxybenzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(O)ccc2O)c(Br)c1 |
| InChI | InChI=1S/C14H11Br2NO3/c1-7-4-10(15)13(11(16)5-7)17-14(20)9-6-8(18)2-3-12(9)19/h2-6,18-19H,1H3,(H,17,20) |
| InChIKey | DEXLVPRNFKFURL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|