C14H10Br2ClNO — CID 2804969
2-chloro-N-(2,6-dibromo-4-methylphenyl)benzamide (PubChem CID 2804969) has the molecular formula C14H10Br2ClNO and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dibromo-4-methylphenyl)benzamide.
| Compound Name | 2-chloro-N-(2,6-dibromo-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 2804969 |
| Molecular Formula | C14H10Br2ClNO |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 2-chloro-N-(2,6-dibromo-4-methylphenyl)benzamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2ccccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C14H10Br2ClNO/c1-8-6-10(15)13(11(16)7-8)18-14(19)9-4-2-3-5-12(9)17/h2-7H,1H3,(H,18,19) |
| InChIKey | FDHNHPNOJRGULZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |