C15H15IN2O2 — CID 107731159
N-(2-amino-4,5-dimethylphenyl)-2-hydroxy-5-iodobenzamide (PubChem CID 107731159) has the molecular formula C15H15IN2O2 and a molecular weight of 382.20 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethylphenyl)-2-hydroxy-5-iodobenzamide.
| Compound Name | N-(2-amino-4,5-dimethylphenyl)-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 107731159 |
| Molecular Formula | C15H15IN2O2 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | N-(2-amino-4,5-dimethylphenyl)-2-hydroxy-5-iodobenzamide |
| SMILES | Cc1cc(N)c(NC(=O)c2cc(I)ccc2O)cc1C |
| InChI | InChI=1S/C15H15IN2O2/c1-8-5-12(17)13(6-9(8)2)18-15(20)11-7-10(16)3-4-14(11)19/h3-7,19H,17H2,1-2H3,(H,18,20) |
| InChIKey | RGMQPDIAVPPKRK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|