C13H11IN2O4 — CID 107731449
4-[(2-hydroxy-5-iodobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 107731449) has the molecular formula C13H11IN2O4 and a molecular weight of 386.15 g/mol. Its IUPAC name is 4-[(2-hydroxy-5-iodobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[(2-hydroxy-5-iodobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 107731449 |
| Molecular Formula | C13H11IN2O4 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4-[(2-hydroxy-5-iodobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)c2cc(I)ccc2O)c1C(=O)O |
| InChI | InChI=1S/C13H11IN2O4/c1-6-11(13(19)20)9(5-15-6)16-12(18)8-4-7(14)2-3-10(8)17/h2-5,15,17H,1H3,(H,16,18)(H,19,20) |
| InChIKey | SYSVCRFKGBFBKR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|