C13H9F3N2O3 — CID 82876120
2-methyl-4-[(3,4,5-trifluorobenzoyl)amino]-1H-pyrrole-3-carboxylic acid (PubChem CID 82876120) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 2-methyl-4-[(3,4,5-trifluorobenzoyl)amino]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2-methyl-4-[(3,4,5-trifluorobenzoyl)amino]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82876120 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-methyl-4-[(3,4,5-trifluorobenzoyl)amino]-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)c2cc(F)c(F)c(F)c2)c1C(=O)O |
| InChI | InChI=1S/C13H9F3N2O3/c1-5-10(13(20)21)9(4-17-5)18-12(19)6-2-7(14)11(16)8(15)3-6/h2-4,17H,1H3,(H,18,19)(H,20,21) |
| InChIKey | GYACWBMHMLVYDD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|