C13H10Cl2N2O3 — CID 82881245
4-[(2,6-dichlorobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 82881245) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82881245 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)c2c(Cl)cccc2Cl)c1C(=O)O |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-6-10(13(19)20)9(5-16-6)17-12(18)11-7(14)3-2-4-8(11)15/h2-5,16H,1H3,(H,17,18)(H,19,20) |
| InChIKey | IOCBOSWLGUCUKO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |