C15H16N2O4 — CID 82875992
4-[[3-(methoxymethyl)benzoyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 82875992) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-[[3-(methoxymethyl)benzoyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[[3-(methoxymethyl)benzoyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82875992 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[[3-(methoxymethyl)benzoyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | COCc1cccc(C(=O)Nc2c[nH]c(C)c2C(=O)O)c1 |
| InChI | InChI=1S/C15H16N2O4/c1-9-13(15(19)20)12(7-16-9)17-14(18)11-5-3-4-10(6-11)8-21-2/h3-7,16H,8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | BEPFYCGNHSQGKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |