C12H9Cl2N3O3 — CID 82881402
4-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 82881402) has the molecular formula C12H9Cl2N3O3 and a molecular weight of 314.13 g/mol. Its IUPAC name is 4-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82881402 |
| Molecular Formula | C12H9Cl2N3O3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 4-[(5,6-dichloropyridine-3-carbonyl)amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)c2cnc(Cl)c(Cl)c2)c1C(=O)O |
| InChI | InChI=1S/C12H9Cl2N3O3/c1-5-9(12(19)20)8(4-15-5)17-11(18)6-2-7(13)10(14)16-3-6/h2-4,15H,1H3,(H,17,18)(H,19,20) |
| InChIKey | WQHQLAQKPNEJQT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|