C12H8Cl2N2O3S — CID 43356628
5-[(5,6-dichloropyridine-3-carbonyl)amino]-3-methylthiophene-2-carboxylic acid (PubChem CID 43356628) has the molecular formula C12H8Cl2N2O3S and a molecular weight of 331.18 g/mol. Its IUPAC name is 5-[(5,6-dichloropyridine-3-carbonyl)amino]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(5,6-dichloropyridine-3-carbonyl)amino]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43356628 |
| Molecular Formula | C12H8Cl2N2O3S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 5-[(5,6-dichloropyridine-3-carbonyl)amino]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2cnc(Cl)c(Cl)c2)sc1C(=O)O |
| InChI | InChI=1S/C12H8Cl2N2O3S/c1-5-2-8(20-9(5)12(18)19)16-11(17)6-3-7(13)10(14)15-4-6/h2-4H,1H3,(H,16,17)(H,18,19) |
| InChIKey | CHGMFJLODCGCAT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|