C9H6Cl2N4OS — CID 4848107
5,6-dichloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 4848107) has the molecular formula C9H6Cl2N4OS and a molecular weight of 289.15 g/mol. Its IUPAC name is 5,6-dichloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4848107 |
| Molecular Formula | C9H6Cl2N4OS |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 5,6-dichloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2cnc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C9H6Cl2N4OS/c1-4-14-15-9(17-4)13-8(16)5-2-6(10)7(11)12-3-5/h2-3H,1H3,(H,13,15,16) |
| InChIKey | RFVNGPXUPHOOMA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|