C13H9ClFNO3S — CID 114914774
3-[(4-chloro-2-fluorobenzoyl)amino]-4-methylthiophene-2-carboxylic acid (PubChem CID 114914774) has the molecular formula C13H9ClFNO3S and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-[(4-chloro-2-fluorobenzoyl)amino]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(4-chloro-2-fluorobenzoyl)amino]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114914774 |
| Molecular Formula | C13H9ClFNO3S |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 3-[(4-chloro-2-fluorobenzoyl)amino]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1NC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H9ClFNO3S/c1-6-5-20-11(13(18)19)10(6)16-12(17)8-3-2-7(14)4-9(8)15/h2-5H,1H3,(H,16,17)(H,18,19) |
| InChIKey | KJDRJIUKINMHMO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |