C11H10IN3O3S — CID 59104321
5-(hydroperoxyamino)-2-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 59104321) has the molecular formula C11H10IN3O3S and a molecular weight of 391.19 g/mol. Its IUPAC name is 5-(hydroperoxyamino)-2-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-(hydroperoxyamino)-2-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 59104321 |
| Molecular Formula | C11H10IN3O3S |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | 5-(hydroperoxyamino)-2-iodo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(NOO)ccc2I)n1 |
| InChI | InChI=1S/C11H10IN3O3S/c1-6-5-19-11(13-6)14-10(16)8-4-7(15-18-17)2-3-9(8)12/h2-5,15,17H,1H3,(H,13,14,16) |
| InChIKey | QXFMDYATOIVODO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|