C10H8FN3OS — CID 107358521
2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 107358521) has the molecular formula C10H8FN3OS and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358521 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1csc(NC(=O)c2cccnc2F)n1 |
| InChI | InChI=1S/C10H8FN3OS/c1-6-5-16-10(13-6)14-9(15)7-3-2-4-12-8(7)11/h2-5H,1H3,(H,13,14,15) |
| InChIKey | CLEFERPJCLVJRS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|