C11H8BrFN2OS — CID 24696228
5-bromo-2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 24696228) has the molecular formula C11H8BrFN2OS and a molecular weight of 315.17 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-bromo-2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 24696228 |
| Molecular Formula | C11H8BrFN2OS |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 5-bromo-2-fluoro-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C11H8BrFN2OS/c1-6-5-17-11(14-6)15-10(16)8-4-7(12)2-3-9(8)13/h2-5H,1H3,(H,14,15,16) |
| InChIKey | RFFGFYCNIZQVPS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |