C17H13FN3O3S2- — CID 175018570
2-[[2-(4-fluoro-N-sulfinatoanilino)benzoyl]amino]-4-methyl-1,3-thiazole (PubChem CID 175018570) has the molecular formula C17H13FN3O3S2- and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[2-(4-fluoro-N-sulfinatoanilino)benzoyl]amino]-4-methyl-1,3-thiazole.
| Compound Name | 2-[[2-(4-fluoro-N-sulfinatoanilino)benzoyl]amino]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 175018570 |
| Molecular Formula | C17H13FN3O3S2- |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-[[2-(4-fluoro-N-sulfinatoanilino)benzoyl]amino]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(NC(=O)c2ccccc2N(c2ccc(F)cc2)S(=O)[O-])n1 |
| InChI | InChI=1S/C17H14FN3O3S2/c1-11-10-25-17(19-11)20-16(22)14-4-2-3-5-15(14)21(26(23)24)13-8-6-12(18)7-9-13/h2-10H,1H3,(H,23,24)(H,19,20,22)/p-1 |
| InChIKey | JGDMSUUUEDPEMQ-UHFFFAOYSA-M |
| XLogP | 3.78 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|