C23H16BrF3N3O3S2- — CID 175016700
4-phenyl-2-[[2-[N-sulfinato-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole;hydrobromide (PubChem CID 175016700) has the molecular formula C23H16BrF3N3O3S2- and a molecular weight of 583.43 g/mol. Its IUPAC name is 4-phenyl-2-[[2-[N-sulfinato-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole;hydrobromide.
| Compound Name | 4-phenyl-2-[[2-[N-sulfinato-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole;hydrobromide |
|---|---|
| PubChem CID | 175016700 |
| Molecular Formula | C23H16BrF3N3O3S2- |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 581.98 |
| IUPAC Name | 4-phenyl-2-[[2-[N-sulfinato-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole;hydrobromide |
| SMILES | Br.O=C(Nc1nc(-c2ccccc2)cs1)c1ccccc1N(c1cccc(C(F)(F)F)c1)S(=O)[O-] |
| InChI | InChI=1S/C23H16F3N3O3S2.BrH/c24-23(25,26)16-9-6-10-17(13-16)29(34(31)32)20-12-5-4-11-18(20)21(30)28-22-27-19(14-33-22)15-7-2-1-3-8-15;/h1-14H,(H,31,32)(H,27,28,30);1H/p-1 |
| InChIKey | BHFSIJWFHSLWJW-UHFFFAOYSA-M |
| XLogP | 6.59 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|