C24H21N3O4S2 — CID 175020993
4-(4-methoxyphenyl)-2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-1,3-thiazole (PubChem CID 175020993) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-1,3-thiazole.
| Compound Name | 4-(4-methoxyphenyl)-2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-1,3-thiazole |
|---|---|
| PubChem CID | 175020993 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(NC(=O)c3ccccc3N(c3ccc(C)cc3)S(=O)O)n2)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-16-7-11-18(12-8-16)27(33(29)30)22-6-4-3-5-20(22)23(28)26-24-25-21(15-32-24)17-9-13-19(31-2)14-10-17/h3-15H,1-2H3,(H,29,30)(H,25,26,28) |
| InChIKey | VJKKRDWUGLNUBH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|