C22H18N4O3S2 — CID 175020667
2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-4-pyridin-3-yl-1,3-thiazole (PubChem CID 175020667) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-4-pyridin-3-yl-1,3-thiazole.
| Compound Name | 2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-4-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 175020667 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[[2-(4-methyl-N-sulfinoanilino)benzoyl]amino]-4-pyridin-3-yl-1,3-thiazole |
| SMILES | Cc1ccc(N(c2ccccc2C(=O)Nc2nc(-c3cccnc3)cs2)S(=O)O)cc1 |
| InChI | InChI=1S/C22H18N4O3S2/c1-15-8-10-17(11-9-15)26(31(28)29)20-7-3-2-6-18(20)21(27)25-22-24-19(14-30-22)16-5-4-12-23-13-16/h2-14H,1H3,(H,28,29)(H,24,25,27) |
| InChIKey | CVMSHHMQFZLVCF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|