C22H20N4OS — CID 55467738
2,5-dimethyl-1-(2-methylphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyrrole-3-carboxamide (PubChem CID 55467738) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2-methylphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-(2-methylphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55467738 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2,5-dimethyl-1-(2-methylphenyl)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pyrrole-3-carboxamide |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)Nc2nc(-c3cccnc3)cs2)c1C |
| InChI | InChI=1S/C22H20N4OS/c1-14-7-4-5-9-20(14)26-15(2)11-18(16(26)3)21(27)25-22-24-19(13-28-22)17-8-6-10-23-12-17/h4-13H,1-3H3,(H,24,25,27) |
| InChIKey | SUJARPJVPQLMPH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|