C25H25N5O2S — CID 55791811
N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55791811) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55791811 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | CC(=O)NC(C)c1ccc(-c2csc(NC(=O)c3cc(C)n(-c4ccccn4)c3C)n2)cc1 |
| InChI | InChI=1S/C25H25N5O2S/c1-15-13-21(17(3)30(15)23-7-5-6-12-26-23)24(32)29-25-28-22(14-33-25)20-10-8-19(9-11-20)16(2)27-18(4)31/h5-14,16H,1-4H3,(H,27,31)(H,28,29,32) |
| InChIKey | JSVKDDCDNURLSX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|