C24H22N4O4S — CID 55434173
N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 55434173) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55434173 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | CC(=O)NC(C)c1ccc(-c2csc(NC(=O)c3cccc(N4C(=O)CCC4=O)c3)n2)cc1 |
| InChI | InChI=1S/C24H22N4O4S/c1-14(25-15(2)29)16-6-8-17(9-7-16)20-13-33-24(26-20)27-23(32)18-4-3-5-19(12-18)28-21(30)10-11-22(28)31/h3-9,12-14H,10-11H2,1-2H3,(H,25,29)(H,26,27,32) |
| InChIKey | SCZNNQYDADSRFJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|