C26H27N3O3S — CID 43000681
4-(2,5-dioxopyrrolidin-1-yl)-N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 43000681) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43000681 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-[2,4-di(propan-2-yl)phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)c3ccc(N4C(=O)CCC4=O)cc3)n2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H27N3O3S/c1-15(2)18-7-10-20(21(13-18)16(3)4)22-14-33-26(27-22)28-25(32)17-5-8-19(9-6-17)29-23(30)11-12-24(29)31/h5-10,13-16H,11-12H2,1-4H3,(H,27,28,32) |
| InChIKey | GVEDZYUQFVVIEO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|