C22H19N3O5S — CID 4581402
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 4581402) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 4581402 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3ccc(N4C(=O)CCC4=O)cc3)n2)c1 |
| InChI | InChI=1S/C22H19N3O5S/c1-29-15-7-8-18(30-2)16(11-15)17-12-31-22(23-17)24-21(28)13-3-5-14(6-4-13)25-19(26)9-10-20(25)27/h3-8,11-12H,9-10H2,1-2H3,(H,23,24,28) |
| InChIKey | ONGJBHVCRAGUJN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|