C20H20N2O3S — CID 71538364
4-tert-butyl-N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 71538364) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 71538364 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-tert-butyl-N-[4-(2,4-dihydroxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2nc(-c3ccc(O)cc3O)cs2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-20(2,3)13-6-4-12(5-7-13)18(25)22-19-21-16(11-26-19)15-9-8-14(23)10-17(15)24/h4-11,23-24H,1-3H3,(H,21,22,25) |
| InChIKey | SAJIRINUGUHWSL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |