C16H9F3N2OS — CID 3524198
N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-fluorobenzamide (PubChem CID 3524198) has the molecular formula C16H9F3N2OS and a molecular weight of 334.32 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-fluorobenzamide.
| Compound Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3524198 |
| Molecular Formula | C16H9F3N2OS |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H9F3N2OS/c17-10-3-1-9(2-4-10)15(22)21-16-20-14(8-23-16)12-6-5-11(18)7-13(12)19/h1-8H,(H,20,21,22) |
| InChIKey | FCQSGKKSWIGRJU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |