C15H8ClF2N3OS — CID 4135604
2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide (PubChem CID 4135604) has the molecular formula C15H8ClF2N3OS and a molecular weight of 351.77 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4135604 |
| Molecular Formula | C15H8ClF2N3OS |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)c1cccnc1Cl |
| InChI | InChI=1S/C15H8ClF2N3OS/c16-13-10(2-1-5-19-13)14(22)21-15-20-12(7-23-15)9-4-3-8(17)6-11(9)18/h1-7H,(H,20,21,22) |
| InChIKey | BAKSNXPRPLSJAY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|