C17H14ClN3OS — CID 8838906
2-chloro-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide (PubChem CID 8838906) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 8838906 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-chloro-N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)c3cccnc3Cl)n2)c1 |
| InChI | InChI=1S/C17H14ClN3OS/c1-10-5-6-11(2)13(8-10)14-9-23-17(20-14)21-16(22)12-4-3-7-19-15(12)18/h3-9H,1-2H3,(H,20,21,22) |
| InChIKey | WNYIOMOZGYPUAC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|