C21H22N2O4S — CID 8838918
N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2,4,5-trimethoxybenzamide (PubChem CID 8838918) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 8838918 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2nc(-c3cc(C)ccc3C)cs2)cc1OC |
| InChI | InChI=1S/C21H22N2O4S/c1-12-6-7-13(2)14(8-12)16-11-28-21(22-16)23-20(24)15-9-18(26-4)19(27-5)10-17(15)25-3/h6-11H,1-5H3,(H,22,23,24) |
| InChIKey | MBDWRJMSSDICRR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |