C15H9ClIN3OS — CID 134041379
2-chloro-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide (PubChem CID 134041379) has the molecular formula C15H9ClIN3OS and a molecular weight of 441.68 g/mol. Its IUPAC name is 2-chloro-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134041379 |
| Molecular Formula | C15H9ClIN3OS |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | 2-chloro-N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(I)cc2)cs1)c1cccnc1Cl |
| InChI | InChI=1S/C15H9ClIN3OS/c16-13-11(2-1-7-18-13)14(21)20-15-19-12(8-22-15)9-3-5-10(17)6-4-9/h1-8H,(H,19,20,21) |
| InChIKey | RDWHGSPMGRLXPF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|