C13H13F2N3OS — CID 156560492
1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-propan-2-ylurea (PubChem CID 156560492) has the molecular formula C13H13F2N3OS and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-propan-2-ylurea.
| Compound Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 156560492 |
| Molecular Formula | C13H13F2N3OS |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1nc(-c2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C13H13F2N3OS/c1-7(2)16-12(19)18-13-17-11(6-20-13)9-4-3-8(14)5-10(9)15/h3-7H,1-2H3,(H2,16,17,18,19) |
| InChIKey | AQKUSBIBZCBILZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |