C23H16F3N3O3S2 — CID 175016701
4-phenyl-2-[[2-[N-sulfino-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole (PubChem CID 175016701) has the molecular formula C23H16F3N3O3S2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 4-phenyl-2-[[2-[N-sulfino-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole.
| Compound Name | 4-phenyl-2-[[2-[N-sulfino-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole |
|---|---|
| PubChem CID | 175016701 |
| Molecular Formula | C23H16F3N3O3S2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 4-phenyl-2-[[2-[N-sulfino-3-(trifluoromethyl)anilino]benzoyl]amino]-1,3-thiazole |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1ccccc1N(c1cccc(C(F)(F)F)c1)S(=O)O |
| InChI | InChI=1S/C23H16F3N3O3S2/c24-23(25,26)16-9-6-10-17(13-16)29(34(31)32)20-12-5-4-11-18(20)21(30)28-22-27-19(14-33-22)15-7-2-1-3-8-15/h1-14H,(H,31,32)(H,27,28,30) |
| InChIKey | XMUQUFMNGGOMGK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|